C37H35NO6 — CID 58008463
8-[3-[2-[[(5R,7S)-3-hydroxy-1-adamantyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one (PubChem CID 58008463) has the molecular formula C37H35NO6 and a molecular weight of 589.69 g/mol. Its IUPAC name is 8-[3-[2-[[(5R,7S)-3-hydroxy-1-adamantyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-[3-[2-[[(5R,7S)-3-hydroxy-1-adamantyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 58008463 |
| Molecular Formula | C37H35NO6 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | 8-[3-[2-[[(5R,7S)-3-hydroxy-1-adamantyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3cccc(OCCNC45C[C@@H]6C[C@@H](CC(O)(C6)C4)C5)c3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C37H35NO6/c1-22-14-30(39)44-34-28(22)10-11-29-32(34)31(25-6-3-2-4-7-25)35(43-29)33(40)26-8-5-9-27(16-26)42-13-12-38-36-17-23-15-24(18-36)20-37(41,19-23)21-36/h2-11,14,16,23-24,38,41H,12-13,15,17-21H2,1H3/t23-,24+,36?,37? |
| InChIKey | RHUXYAKVZQINKP-PUJSVYCESA-N |
| XLogP | 6.80 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|