C33H31NO5 — CID 44600368
4-methyl-9-phenyl-8-[3-(3-piperidin-1-ylpropoxy)benzoyl]furo[2,3-h]chromen-2-one (PubChem CID 44600368) has the molecular formula C33H31NO5 and a molecular weight of 521.61 g/mol. Its IUPAC name is 4-methyl-9-phenyl-8-[3-(3-piperidin-1-ylpropoxy)benzoyl]furo[2,3-h]chromen-2-one.
| Compound Name | 4-methyl-9-phenyl-8-[3-(3-piperidin-1-ylpropoxy)benzoyl]furo[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 44600368 |
| Molecular Formula | C33H31NO5 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 4-methyl-9-phenyl-8-[3-(3-piperidin-1-ylpropoxy)benzoyl]furo[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3cccc(OCCCN4CCCCC4)c3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C33H31NO5/c1-22-20-28(35)39-32-26(22)14-15-27-30(32)29(23-10-4-2-5-11-23)33(38-27)31(36)24-12-8-13-25(21-24)37-19-9-18-34-16-6-3-7-17-34/h2,4-5,8,10-15,20-21H,3,6-7,9,16-19H2,1H3 |
| InChIKey | FGAQHJZPUDZCAS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|