C29H22O5 — CID 44600205
8-(3-but-3-enoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one (PubChem CID 44600205) has the molecular formula C29H22O5 and a molecular weight of 450.49 g/mol. Its IUPAC name is 8-(3-but-3-enoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-(3-but-3-enoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 44600205 |
| Molecular Formula | C29H22O5 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 8-(3-but-3-enoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
| SMILES | C=CCCOc1cccc(C(=O)c2oc3ccc4c(C)cc(=O)oc4c3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C29H22O5/c1-3-4-15-32-21-12-8-11-20(17-21)27(31)29-25(19-9-6-5-7-10-19)26-23(33-29)14-13-22-18(2)16-24(30)34-28(22)26/h3,5-14,16-17H,1,4,15H2,2H3 |
| InChIKey | IHFLQSVTQTVVOX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|