C35H27NO5 — CID 44599241
8-[3-[2-(1,3-dihydroisoindol-2-yl)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one (PubChem CID 44599241) has the molecular formula C35H27NO5 and a molecular weight of 541.60 g/mol. Its IUPAC name is 8-[3-[2-(1,3-dihydroisoindol-2-yl)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-[3-[2-(1,3-dihydroisoindol-2-yl)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 44599241 |
| Molecular Formula | C35H27NO5 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 8-[3-[2-(1,3-dihydroisoindol-2-yl)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3cccc(OCCN4Cc5ccccc5C4)c3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C35H27NO5/c1-22-18-30(37)41-34-28(22)14-15-29-32(34)31(23-8-3-2-4-9-23)35(40-29)33(38)24-12-7-13-27(19-24)39-17-16-36-20-25-10-5-6-11-26(25)21-36/h2-15,18-19H,16-17,20-21H2,1H3 |
| InChIKey | VMKOHFSOXKOJOM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|