C30H25BrO5 — CID 58008437
9-(3-bromophenyl)-4-methyl-8-(3-pentoxybenzoyl)furo[2,3-h]chromen-2-one (PubChem CID 58008437) has the molecular formula C30H25BrO5 and a molecular weight of 545.43 g/mol. Its IUPAC name is 9-(3-bromophenyl)-4-methyl-8-(3-pentoxybenzoyl)furo[2,3-h]chromen-2-one.
| Compound Name | 9-(3-bromophenyl)-4-methyl-8-(3-pentoxybenzoyl)furo[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 58008437 |
| Molecular Formula | C30H25BrO5 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 9-(3-bromophenyl)-4-methyl-8-(3-pentoxybenzoyl)furo[2,3-h]chromen-2-one |
| SMILES | CCCCCOc1cccc(C(=O)c2oc3ccc4c(C)cc(=O)oc4c3c2-c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C30H25BrO5/c1-3-4-5-14-34-22-11-7-9-20(17-22)28(33)30-26(19-8-6-10-21(31)16-19)27-24(35-30)13-12-23-18(2)15-25(32)36-29(23)27/h6-13,15-17H,3-5,14H2,1-2H3 |
| InChIKey | CYMVJIXEFHPEKZ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|