C28H21ClO5 — CID 44600052
8-[3-(3-chloropropoxy)benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one (PubChem CID 44600052) has the molecular formula C28H21ClO5 and a molecular weight of 472.92 g/mol. Its IUPAC name is 8-[3-(3-chloropropoxy)benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-[3-(3-chloropropoxy)benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 44600052 |
| Molecular Formula | C28H21ClO5 |
| Molecular Weight | 472.92 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 8-[3-(3-chloropropoxy)benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3cccc(OCCCCl)c3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C28H21ClO5/c1-17-15-23(30)34-27-21(17)11-12-22-25(27)24(18-7-3-2-4-8-18)28(33-22)26(31)19-9-5-10-20(16-19)32-14-6-13-29/h2-5,7-12,15-16H,6,13-14H2,1H3 |
| InChIKey | QMPBCSBUFHMNBV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.92 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|