C38H37NO6 — CID 89122805
8-[3-[2-[[(3R,7S)-3-hydroxy-7-tricyclo[5.3.1.03,9]undecanyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one (PubChem CID 89122805) has the molecular formula C38H37NO6 and a molecular weight of 603.72 g/mol. Its IUPAC name is 8-[3-[2-[[(3R,7S)-3-hydroxy-7-tricyclo[5.3.1.03,9]undecanyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-[3-[2-[[(3R,7S)-3-hydroxy-7-tricyclo[5.3.1.03,9]undecanyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 89122805 |
| Molecular Formula | C38H37NO6 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 8-[3-[2-[[(3R,7S)-3-hydroxy-7-tricyclo[5.3.1.03,9]undecanyl]amino]ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3cccc(OCCN[C@]45CCC[C@@]6(O)CC(CC6C4)C5)c3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C38H37NO6/c1-23-17-31(40)45-35-29(23)11-12-30-33(35)32(25-7-3-2-4-8-25)36(44-30)34(41)26-9-5-10-28(19-26)43-16-15-39-37-13-6-14-38(42)21-24(20-37)18-27(38)22-37/h2-5,7-12,17,19,24,27,39,42H,6,13-16,18,20-22H2,1H3/t24?,27?,37-,38+/m0/s1 |
| InChIKey | MUOYKZQQUPHNIU-BSBGVXFOSA-N |
| XLogP | 7.19 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|