C32H30O4 — CID 70668364
(3-hexoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone (PubChem CID 70668364) has the molecular formula C32H30O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is (3-hexoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone.
| Compound Name | (3-hexoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone |
|---|---|
| PubChem CID | 70668364 |
| Molecular Formula | C32H30O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (3-hexoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone |
| SMILES | C=C1C=C(C)c2ccc3oc(C(=O)c4cccc(OCCCCCC)c4)c(-c4ccccc4)c3c2O1 |
| InChI | InChI=1S/C32H30O4/c1-4-5-6-10-18-34-25-15-11-14-24(20-25)30(33)32-28(23-12-8-7-9-13-23)29-27(36-32)17-16-26-21(2)19-22(3)35-31(26)29/h7-9,11-17,19-20H,3-6,10,18H2,1-2H3 |
| InChIKey | PPVKTJYFTKUXNY-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|