C28H22O4 — CID 89122804
(4-methoxy-3-phenyl-5-prop-1-en-2-yl-1-benzofuran-2-yl)-(3-prop-2-ynoxyphenyl)methanone (PubChem CID 89122804) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is (4-methoxy-3-phenyl-5-prop-1-en-2-yl-1-benzofuran-2-yl)-(3-prop-2-ynoxyphenyl)methanone.
| Compound Name | (4-methoxy-3-phenyl-5-prop-1-en-2-yl-1-benzofuran-2-yl)-(3-prop-2-ynoxyphenyl)methanone |
|---|---|
| PubChem CID | 89122804 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (4-methoxy-3-phenyl-5-prop-1-en-2-yl-1-benzofuran-2-yl)-(3-prop-2-ynoxyphenyl)methanone |
| SMILES | C#CCOc1cccc(C(=O)c2oc3ccc(C(=C)C)c(OC)c3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C28H22O4/c1-5-16-31-21-13-9-12-20(17-21)26(29)28-24(19-10-7-6-8-11-19)25-23(32-28)15-14-22(18(2)3)27(25)30-4/h1,6-15,17H,2,16H2,3-4H3 |
| InChIKey | YODHROCCPVFELW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|