C30H26O4 — CID 70668322
(3-butoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone (PubChem CID 70668322) has the molecular formula C30H26O4 and a molecular weight of 450.53 g/mol. Its IUPAC name is (3-butoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone.
| Compound Name | (3-butoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone |
|---|---|
| PubChem CID | 70668322 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (3-butoxyphenyl)-(4-methyl-2-methylidene-9-phenylfuro[2,3-h]chromen-8-yl)methanone |
| SMILES | C=C1C=C(C)c2ccc3oc(C(=O)c4cccc(OCCCC)c4)c(-c4ccccc4)c3c2O1 |
| InChI | InChI=1S/C30H26O4/c1-4-5-16-32-23-13-9-12-22(18-23)28(31)30-26(21-10-7-6-8-11-21)27-25(34-30)15-14-24-19(2)17-20(3)33-29(24)27/h6-15,17-18H,3-5,16H2,1-2H3 |
| InChIKey | NZULZDZUSOQYHW-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|