C30H18O4 — CID 44553869
8-benzoyl-4,9-diphenylfuro[2,3-h]chromen-2-one (PubChem CID 44553869) has the molecular formula C30H18O4 and a molecular weight of 442.47 g/mol. Its IUPAC name is 8-benzoyl-4,9-diphenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-benzoyl-4,9-diphenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 44553869 |
| Molecular Formula | C30H18O4 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 8-benzoyl-4,9-diphenylfuro[2,3-h]chromen-2-one |
| SMILES | O=C(c1ccccc1)c1oc2ccc3c(-c4ccccc4)cc(=O)oc3c2c1-c1ccccc1 |
| InChI | InChI=1S/C30H18O4/c31-25-18-23(19-10-4-1-5-11-19)22-16-17-24-27(29(22)34-25)26(20-12-6-2-7-13-20)30(33-24)28(32)21-14-8-3-9-15-21/h1-18H |
| InChIKey | GGSAUVIUOBDVTM-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|