C20H29NO2S — CID 142111777
3-[2-(diethylamino)ethyl]-4,8-dimethyl-7-propoxychromene-2-thione (PubChem CID 142111777) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl]-4,8-dimethyl-7-propoxychromene-2-thione.
| Compound Name | 3-[2-(diethylamino)ethyl]-4,8-dimethyl-7-propoxychromene-2-thione |
|---|---|
| PubChem CID | 142111777 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-[2-(diethylamino)ethyl]-4,8-dimethyl-7-propoxychromene-2-thione |
| SMILES | CCCOc1ccc2c(C)c(CCN(CC)CC)c(=S)oc2c1C |
| InChI | InChI=1S/C20H29NO2S/c1-6-13-22-18-10-9-16-14(4)17(11-12-21(7-2)8-3)20(24)23-19(16)15(18)5/h9-10H,6-8,11-13H2,1-5H3 |
| InChIKey | IQKVRMCOTVBDJP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|