C13H17NO3 — CID 39097258
2-(7-methyl-6-propoxy-1,2-benzoxazol-3-yl)ethanol (PubChem CID 39097258) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(7-methyl-6-propoxy-1,2-benzoxazol-3-yl)ethanol.
| Compound Name | 2-(7-methyl-6-propoxy-1,2-benzoxazol-3-yl)ethanol |
|---|---|
| PubChem CID | 39097258 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(7-methyl-6-propoxy-1,2-benzoxazol-3-yl)ethanol |
| SMILES | CCCOc1ccc2c(CCO)noc2c1C |
| InChI | InChI=1S/C13H17NO3/c1-3-8-16-12-5-4-10-11(6-7-15)14-17-13(10)9(12)2/h4-5,15H,3,6-8H2,1-2H3 |
| InChIKey | DAUNGVIYOMKCQY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |