C15H18ClNO3 — CID 82027280
3-(2-chloroethyl)-7-methyl-6-(oxolan-2-ylmethoxy)-1,2-benzoxazole (PubChem CID 82027280) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 3-(2-chloroethyl)-7-methyl-6-(oxolan-2-ylmethoxy)-1,2-benzoxazole.
| Compound Name | 3-(2-chloroethyl)-7-methyl-6-(oxolan-2-ylmethoxy)-1,2-benzoxazole |
|---|---|
| PubChem CID | 82027280 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-(2-chloroethyl)-7-methyl-6-(oxolan-2-ylmethoxy)-1,2-benzoxazole |
| SMILES | Cc1c(OCC2CCCO2)ccc2c(CCCl)noc12 |
| InChI | InChI=1S/C15H18ClNO3/c1-10-14(19-9-11-3-2-8-18-11)5-4-12-13(6-7-16)17-20-15(10)12/h4-5,11H,2-3,6-9H2,1H3 |
| InChIKey | KFKHSENZMBLETH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|