C19H24N2O4S — CID 51240387
N-(1,1-dioxothiolan-3-yl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 51240387) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51240387 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N2O4S/c22-18(7-6-15-4-2-1-3-5-15)21-11-8-16(9-12-21)19(23)20-17-10-13-26(24,25)14-17/h1-7,16-17H,8-14H2,(H,20,23)/b7-6+ |
| InChIKey | AZQIIOKAEOEMET-VOTSOKGWSA-N |
| XLogP | 1.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|