C20H18F3N3O — CID 94886643
N-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzo[f]quinoline-5-carboxamide (PubChem CID 94886643) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is N-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzo[f]quinoline-5-carboxamide.
| Compound Name | N-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzo[f]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 94886643 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzo[f]quinoline-5-carboxamide |
| SMILES | O=C(N[C@H]1CCN(CC(F)(F)F)C1)c1cc2ccccc2c2cccnc12 |
| InChI | InChI=1S/C20H18F3N3O/c21-20(22,23)12-26-9-7-14(11-26)25-19(27)17-10-13-4-1-2-5-15(13)16-6-3-8-24-18(16)17/h1-6,8,10,14H,7,9,11-12H2,(H,25,27)/t14-/m0/s1 |
| InChIKey | FOJYLXRSUQKUAJ-AWEZNQCLSA-N |
| XLogP | 3.75 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|