C20H23Cl2N3O — CID 119477643
N-(4-aminocyclohexyl)benzo[f]quinoline-5-carboxamide;dihydrochloride (PubChem CID 119477643) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)benzo[f]quinoline-5-carboxamide;dihydrochloride.
| Compound Name | N-(4-aminocyclohexyl)benzo[f]quinoline-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119477643 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(4-aminocyclohexyl)benzo[f]quinoline-5-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(NC(=O)c2cc3ccccc3c3cccnc23)CC1 |
| InChI | InChI=1S/C20H21N3O.2ClH/c21-14-7-9-15(10-8-14)23-20(24)18-12-13-4-1-2-5-16(13)17-6-3-11-22-19(17)18;;/h1-6,11-12,14-15H,7-10,21H2,(H,23,24);2*1H |
| InChIKey | XIFNXMGMADCNFV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|