C13H14N4O3S — CID 71159487
2-amino-N-(1,1-dioxothiolan-3-yl)quinazoline-8-carboxamide (PubChem CID 71159487) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothiolan-3-yl)quinazoline-8-carboxamide.
| Compound Name | 2-amino-N-(1,1-dioxothiolan-3-yl)quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 71159487 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-amino-N-(1,1-dioxothiolan-3-yl)quinazoline-8-carboxamide |
| SMILES | Nc1ncc2cccc(C(=O)NC3CCS(=O)(=O)C3)c2n1 |
| InChI | InChI=1S/C13H14N4O3S/c14-13-15-6-8-2-1-3-10(11(8)17-13)12(18)16-9-4-5-21(19,20)7-9/h1-3,6,9H,4-5,7H2,(H,16,18)(H2,14,15,17) |
| InChIKey | HWGHRUTUPLBFGI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |