C13H19FN2O3S — CID 63923493
2-N-(1,1-dioxothian-3-yl)-4-ethoxy-5-fluorobenzene-1,2-diamine (PubChem CID 63923493) has the molecular formula C13H19FN2O3S and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-N-(1,1-dioxothian-3-yl)-4-ethoxy-5-fluorobenzene-1,2-diamine.
| Compound Name | 2-N-(1,1-dioxothian-3-yl)-4-ethoxy-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 63923493 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-N-(1,1-dioxothian-3-yl)-4-ethoxy-5-fluorobenzene-1,2-diamine |
| SMILES | CCOc1cc(NC2CCCS(=O)(=O)C2)c(N)cc1F |
| InChI | InChI=1S/C13H19FN2O3S/c1-2-19-13-7-12(11(15)6-10(13)14)16-9-4-3-5-20(17,18)8-9/h6-7,9,16H,2-5,8,15H2,1H3 |
| InChIKey | FFDOUKBGNGJVBD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|