C16H24BrNO4S — CID 55387058
2-bromo-N-(2,3-dimethylcyclohexyl)-4,5-dimethoxybenzenesulfonamide (PubChem CID 55387058) has the molecular formula C16H24BrNO4S and a molecular weight of 406.34 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dimethylcyclohexyl)-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-bromo-N-(2,3-dimethylcyclohexyl)-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 55387058 |
| Molecular Formula | C16H24BrNO4S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-bromo-N-(2,3-dimethylcyclohexyl)-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)NC2CCCC(C)C2C)cc1OC |
| InChI | InChI=1S/C16H24BrNO4S/c1-10-6-5-7-13(11(10)2)18-23(19,20)16-9-15(22-4)14(21-3)8-12(16)17/h8-11,13,18H,5-7H2,1-4H3 |
| InChIKey | OTFLNHVELDLAER-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |