C16H19ClN2O5S2 — CID 56578391
4-[2-(4-chlorophenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide (PubChem CID 56578391) has the molecular formula C16H19ClN2O5S2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 4-[2-(4-chlorophenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | 4-[2-(4-chlorophenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 56578391 |
| Molecular Formula | C16H19ClN2O5S2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 4-[2-(4-chlorophenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide |
| SMILES | CN(CCOc1ccc(Cl)cc1)c1ccc(S(N)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C16H19ClN2O5S2/c1-19(9-10-24-13-5-3-12(17)4-6-13)15-8-7-14(26(18,22)23)11-16(15)25(2,20)21/h3-8,11H,9-10H2,1-2H3,(H2,18,22,23) |
| InChIKey | NQLLTMNWXCGPEU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |