C16H17F3N2O5S2 — CID 56578932
3-methylsulfonyl-4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]benzenesulfonamide (PubChem CID 56578932) has the molecular formula C16H17F3N2O5S2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 3-methylsulfonyl-4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]benzenesulfonamide.
| Compound Name | 3-methylsulfonyl-4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 56578932 |
| Molecular Formula | C16H17F3N2O5S2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 3-methylsulfonyl-4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]benzenesulfonamide |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)c1ccc(S(N)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C16H17F3N2O5S2/c1-21(10-11-5-3-4-6-14(11)26-16(17,18)19)13-8-7-12(28(20,24)25)9-15(13)27(2,22)23/h3-9H,10H2,1-2H3,(H2,20,24,25) |
| InChIKey | QOKKTYOESRHMQY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |