C27H19N5O5S — CID 3299822
N-[1,4-dioxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]naphthalen-2-yl]benzamide (PubChem CID 3299822) has the molecular formula C27H19N5O5S and a molecular weight of 525.55 g/mol. Its IUPAC name is N-[1,4-dioxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]naphthalen-2-yl]benzamide.
| Compound Name | N-[1,4-dioxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 3299822 |
| Molecular Formula | C27H19N5O5S |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | N-[1,4-dioxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]naphthalen-2-yl]benzamide |
| SMILES | O=C(NC1=C(Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H19N5O5S/c33-24-20-9-4-5-10-21(20)25(34)23(31-26(35)17-7-2-1-3-8-17)22(24)30-18-11-13-19(14-12-18)38(36,37)32-27-28-15-6-16-29-27/h1-16,30H,(H,31,35)(H,28,29,32) |
| InChIKey | VRLRWMDYLOFGHT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|