C17H16ClN3O4S — CID 4980812
N-[[[2-(2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide (PubChem CID 4980812) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is N-[[[2-(2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide.
| Compound Name | N-[[[2-(2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4980812 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[[[2-(2-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(=S)NNC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C17H16ClN3O4S/c1-24-13-8-4-2-6-11(13)16(23)19-17(26)21-20-15(22)10-25-14-9-5-3-7-12(14)18/h2-9H,10H2,1H3,(H,20,22)(H2,19,21,23,26) |
| InChIKey | DNASJXMWKBQVJS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|