C19H15F3N2OS — CID 9050475
2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9050475) has the molecular formula C19H15F3N2OS and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9050475 |
| Molecular Formula | C19H15F3N2OS |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN[C@H](c1ccccc1)c1cccs1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H15F3N2OS/c20-13-8-9-14(18(22)17(13)21)24-16(25)11-23-19(15-7-4-10-26-15)12-5-2-1-3-6-12/h1-10,19,23H,11H2,(H,24,25)/t19-/m1/s1 |
| InChIKey | SBIVMFYGODUIBZ-LJQANCHMSA-N |
| XLogP | 4.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|