C19H22N2O4 — CID 9066149
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate (PubChem CID 9066149) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9066149 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@@H]1C=CCC1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C19H22N2O4/c22-17(12-25-18(23)11-13-5-1-2-6-13)21-16-8-4-3-7-15(16)19(24)20-14-9-10-14/h1,3-5,7-8,13-14H,2,6,9-12H2,(H,20,24)(H,21,22)/t13-/m1/s1 |
| InChIKey | OZJZYQFODSCKAR-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|