C18H16ClF3N2O5S — CID 42983764
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate (PubChem CID 42983764) has the molecular formula C18H16ClF3N2O5S and a molecular weight of 464.85 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42983764 |
| Molecular Formula | C18H16ClF3N2O5S |
| Molecular Weight | 464.85 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16ClF3N2O5S/c1-2-23-30(27,28)13-5-3-4-11(8-13)17(26)29-10-16(25)24-15-7-6-12(19)9-14(15)18(20,21)22/h3-9,23H,2,10H2,1H3,(H,24,25) |
| InChIKey | FOIMBJBBBKJGLE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.85 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |