C15H16N2O4 — CID 8544424
[2-(2-ethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8544424) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8544424 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H16N2O4/c1-2-20-13-8-4-3-6-11(13)17-14(18)10-21-15(19)12-7-5-9-16-12/h3-9,16H,2,10H2,1H3,(H,17,18) |
| InChIKey | XDCPFSXTVHCLRS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |