C15H13Br2NO4S — CID 35987517
[2-(2-ethoxyanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate (PubChem CID 35987517) has the molecular formula C15H13Br2NO4S and a molecular weight of 463.15 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 35987517 |
| Molecular Formula | C15H13Br2NO4S |
| Molecular Weight | 463.15 g/mol |
| Exact Mass | 460.89 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H13Br2NO4S/c1-2-21-11-6-4-3-5-10(11)18-13(19)8-22-15(20)12-7-9(16)14(17)23-12/h3-7H,2,8H2,1H3,(H,18,19) |
| InChIKey | LGUBUSYIBOBERM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.15 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |