C15H11Br2NO4S — CID 35966583
[2-(2-acetylanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate (PubChem CID 35966583) has the molecular formula C15H11Br2NO4S and a molecular weight of 461.13 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 35966583 |
| Molecular Formula | C15H11Br2NO4S |
| Molecular Weight | 461.13 g/mol |
| Exact Mass | 458.88 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 4,5-dibromothiophene-2-carboxylate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H11Br2NO4S/c1-8(19)9-4-2-3-5-11(9)18-13(20)7-22-15(21)12-6-10(16)14(17)23-12/h2-6H,7H2,1H3,(H,18,20) |
| InChIKey | JHFJMZYRDDMOEK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.13 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |