C20H23ClN2O2 — CID 7182344
(3S)-3-(1-adamantylamino)-1-(3-chlorophenyl)pyrrolidine-2,5-dione (PubChem CID 7182344) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is (3S)-3-(1-adamantylamino)-1-(3-chlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(1-adamantylamino)-1-(3-chlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7182344 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (3S)-3-(1-adamantylamino)-1-(3-chlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](NC23CC4CC(CC(C4)C2)C3)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O2/c21-15-2-1-3-16(7-15)23-18(24)8-17(19(23)25)22-20-9-12-4-13(10-20)6-14(5-12)11-20/h1-3,7,12-14,17,22H,4-6,8-11H2/t12?,13?,14?,17-,20?/m0/s1 |
| InChIKey | HUADOTDIDMFKCD-UTNBAMHJSA-N |
| XLogP | 3.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|