C23H28N2O4 — CID 7459837
ethyl 4-[(3S)-3-(1-adamantylamino)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 7459837) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-(1-adamantylamino)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-(1-adamantylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 7459837 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | ethyl 4-[(3S)-3-(1-adamantylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](NC34CC5CC(CC(C5)C3)C4)C2=O)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-29-22(28)17-3-5-18(6-4-17)25-20(26)10-19(21(25)27)24-23-11-14-7-15(12-23)9-16(8-14)13-23/h3-6,14-16,19,24H,2,7-13H2,1H3/t14?,15?,16?,19-,23?/m0/s1 |
| InChIKey | QETXBNQYNZTDNM-HAVBXNNZSA-N |
| XLogP | 3.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|