C26H25N3O5S — CID 3978489
N-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methoxy-N'-(2-thiophen-2-ylacetyl)benzohydrazide (PubChem CID 3978489) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methoxy-N'-(2-thiophen-2-ylacetyl)benzohydrazide.
| Compound Name | N-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methoxy-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 3978489 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methoxy-N'-(2-thiophen-2-ylacetyl)benzohydrazide |
| SMILES | COc1ccccc1C(=O)N(NC(=O)Cc1cccs1)C1CC(=O)N(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C26H25N3O5S/c1-16-10-11-18(13-17(16)2)28-24(31)15-21(26(28)33)29(27-23(30)14-19-7-6-12-35-19)25(32)20-8-4-5-9-22(20)34-3/h4-13,21H,14-15H2,1-3H3,(H,27,30) |
| InChIKey | WLQYBISWGINRBO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|