C15H18FNO3 — CID 82324866
3-[cyclopentyl-(4-fluorobenzoyl)amino]propanoic acid (PubChem CID 82324866) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 3-[cyclopentyl-(4-fluorobenzoyl)amino]propanoic acid.
| Compound Name | 3-[cyclopentyl-(4-fluorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82324866 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[cyclopentyl-(4-fluorobenzoyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)c1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C15H18FNO3/c16-12-7-5-11(6-8-12)15(20)17(10-9-14(18)19)13-3-1-2-4-13/h5-8,13H,1-4,9-10H2,(H,18,19) |
| InChIKey | SIQUULFPPICHSE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |