C22H26FNO3S — CID 78853833
N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 78853833) has the molecular formula C22H26FNO3S and a molecular weight of 403.52 g/mol. Its IUPAC name is N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 78853833 |
| Molecular Formula | C22H26FNO3S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)N(CCc2ccc(F)cc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C22H26FNO3S/c1-28(26,27)16-18-6-10-19(11-7-18)22(25)24(21-4-2-3-5-21)15-14-17-8-12-20(23)13-9-17/h6-13,21H,2-5,14-16H2,1H3 |
| InChIKey | FJOBVURZICXJIF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |