C20H20F4N2O — CID 78853634
N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 78853634) has the molecular formula C20H20F4N2O and a molecular weight of 380.39 g/mol. Its IUPAC name is N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78853634 |
| Molecular Formula | C20H20F4N2O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1)N(CCc1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C20H20F4N2O/c21-16-8-5-14(6-9-16)11-12-26(17-3-1-2-4-17)19(27)15-7-10-18(25-13-15)20(22,23)24/h5-10,13,17H,1-4,11-12H2 |
| InChIKey | SLPGQXHJEAAODM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |