C18H19BrFNO2 — CID 78853656
5-bromo-N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]furan-3-carboxamide (PubChem CID 78853656) has the molecular formula C18H19BrFNO2 and a molecular weight of 380.26 g/mol. Its IUPAC name is 5-bromo-N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]furan-3-carboxamide.
| Compound Name | 5-bromo-N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 78853656 |
| Molecular Formula | C18H19BrFNO2 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5-bromo-N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]furan-3-carboxamide |
| SMILES | O=C(c1coc(Br)c1)N(CCc1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C18H19BrFNO2/c19-17-11-14(12-23-17)18(22)21(16-3-1-2-4-16)10-9-13-5-7-15(20)8-6-13/h5-8,11-12,16H,1-4,9-10H2 |
| InChIKey | DCBGYGZGLHSXFE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |