C23H27FN2O3S — CID 78853544
N-cyclopentyl-3-(cyclopropylsulfamoyl)-N-[2-(4-fluorophenyl)ethyl]benzamide (PubChem CID 78853544) has the molecular formula C23H27FN2O3S and a molecular weight of 430.55 g/mol. Its IUPAC name is N-cyclopentyl-3-(cyclopropylsulfamoyl)-N-[2-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | N-cyclopentyl-3-(cyclopropylsulfamoyl)-N-[2-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 78853544 |
| Molecular Formula | C23H27FN2O3S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-cyclopentyl-3-(cyclopropylsulfamoyl)-N-[2-(4-fluorophenyl)ethyl]benzamide |
| SMILES | O=C(c1cccc(S(=O)(=O)NC2CC2)c1)N(CCc1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C23H27FN2O3S/c24-19-10-8-17(9-11-19)14-15-26(21-5-1-2-6-21)23(27)18-4-3-7-22(16-18)30(28,29)25-20-12-13-20/h3-4,7-11,16,20-21,25H,1-2,5-6,12-15H2 |
| InChIKey | IHJPNZWYCPCPLQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |