C21H24FN3O4S — CID 55359807
3-(cyclopropylsulfamoyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]benzamide (PubChem CID 55359807) has the molecular formula C21H24FN3O4S and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55359807 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]benzamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C21H24FN3O4S/c1-2-25(14-20(26)23-13-15-6-8-17(22)9-7-15)21(27)16-4-3-5-19(12-16)30(28,29)24-18-10-11-18/h3-9,12,18,24H,2,10-11,13-14H2,1H3,(H,23,26) |
| InChIKey | FWYGQJPUSABYGO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |