C24H29FN2O3S — CID 78853789
N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 78853789) has the molecular formula C24H29FN2O3S and a molecular weight of 444.57 g/mol. Its IUPAC name is N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 78853789 |
| Molecular Formula | C24H29FN2O3S |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-cyclopentyl-N-[2-(4-fluorophenyl)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCCC2)c1)N(CCc1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C24H29FN2O3S/c25-21-12-10-19(11-13-21)14-17-27(22-7-1-2-8-22)24(28)20-6-5-9-23(18-20)31(29,30)26-15-3-4-16-26/h5-6,9-13,18,22H,1-4,7-8,14-17H2 |
| InChIKey | QNLDDBYGJQLAID-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |