C21H22F3NO3S — CID 78853831
N-cyclopentyl-4-(difluoromethylsulfonyl)-N-[2-(4-fluorophenyl)ethyl]benzamide (PubChem CID 78853831) has the molecular formula C21H22F3NO3S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-cyclopentyl-4-(difluoromethylsulfonyl)-N-[2-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | N-cyclopentyl-4-(difluoromethylsulfonyl)-N-[2-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 78853831 |
| Molecular Formula | C21H22F3NO3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-cyclopentyl-4-(difluoromethylsulfonyl)-N-[2-(4-fluorophenyl)ethyl]benzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)C(F)F)cc1)N(CCc1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C21H22F3NO3S/c22-17-9-5-15(6-10-17)13-14-25(18-3-1-2-4-18)20(26)16-7-11-19(12-8-16)29(27,28)21(23)24/h5-12,18,21H,1-4,13-14H2 |
| InChIKey | XORPGBYQVIOGDW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |