C11H17N3O4 — CID 167715233
tert-butyl 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoate (PubChem CID 167715233) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is tert-butyl 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoate.
| Compound Name | tert-butyl 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoate |
|---|---|
| PubChem CID | 167715233 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | tert-butyl 2-amino-3-(2,4-dioxo-1H-pyrimidin-5-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(N)Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O4/c1-11(2,3)18-9(16)7(12)4-6-5-13-10(17)14-8(6)15/h5,7H,4,12H2,1-3H3,(H2,13,14,15,17) |
| InChIKey | GSQWSTKVDWVWND-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |