C18H18N2O5 — CID 122463751
4-O-benzyl 1-O-[2-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)ethyl] (E)-but-2-enedioate (PubChem CID 122463751) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-O-benzyl 1-O-[2-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)ethyl] (E)-but-2-enedioate.
| Compound Name | 4-O-benzyl 1-O-[2-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122463751 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-O-benzyl 1-O-[2-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)ethyl] (E)-but-2-enedioate |
| SMILES | C=C1NC=C(CCOC(=O)/C=C/C(=O)OCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C18H18N2O5/c1-13-19-11-15(18(23)20-13)9-10-24-16(21)7-8-17(22)25-12-14-5-3-2-4-6-14/h2-8,11,19H,1,9-10,12H2,(H,20,23)/b8-7+ |
| InChIKey | QYOPTVYHSGUPKO-BQYQJAHWSA-N |
| XLogP | 1.29 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|