About ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate
ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate (PubChem CID 131747476) has the molecular formula C19H29O8-
and a molecular weight of 385.43 g/mol. Its IUPAC name is ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate.
Molecular Properties
| Compound Name | ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate |
| PubChem CID | 131747476 |
| Molecular Formula | C19H29O8- |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C(=O)OC(C)(C)C.CC(C)OC(=O)/C=C/C(=O)[O-] |
| InChI | InChI=1S/C12H20O4.C7H10O4/c1-11(2,3)15-9(13)7-8-10(14)16-12(4,5)6;1-5(2)11-7(10)4-3-6(8)9/h7-8H,1-6H3;3-5H,1-2H3,(H,8,9)/p-1/b8-7+;4-3+ |
| InChIKey | UVYUZYTUWSQBPE-KGHXOJBXSA-M |
| XLogP | 1.47 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate?
The IUPAC name of ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate (CID 131747476) is ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate.
What is the SMILES notation for ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate?
The canonical SMILES for ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate is CC(C)(C)OC(=O)/C=C/C(=O)OC(C)(C)C.CC(C)OC(=O)/C=C/C(=O)[O-].
What is the InChIKey of ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate?
The InChIKey is UVYUZYTUWSQBPE-KGHXOJBXSA-M. The full InChI is InChI=1S/C12H20O4.C7H10O4/c1-11(2,3)15-9(13)7-8-10(14)16-12(4,5)6;1-5(2)11-7(10)4-3-6(8)9/h7-8H,1-6H3;3-5H,1-2H3,(H,8,9)/p-1/b8-7+;4-3+.
What are the key properties of ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate?
ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate has a molecular weight of 385.43 g/mol, XLogP of 1.47, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (E)-but-2-enedioate;(E)-4-oxo-4-propan-2-yloxybut-2-enoate is sourced from PubChem (CID 131747476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).