C11H19O4- — CID 134894311
(E)-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate (PubChem CID 134894311) has the molecular formula C11H19O4- and a molecular weight of 215.27 g/mol. Its IUPAC name is (E)-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate.
| Compound Name | (E)-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 134894311 |
| Molecular Formula | C11H19O4- |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (E)-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate |
| SMILES | CC(C)(C)OC(=O)/C=C(\[O-])OC(C)(C)C |
| InChI | InChI=1S/C11H20O4/c1-10(2,3)14-8(12)7-9(13)15-11(4,5)6/h7,12H,1-6H3/p-1/b8-7+ |
| InChIKey | NDBWELDYYKCRCM-BQYQJAHWSA-M |
| XLogP | 1.34 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|