C16H29NO4 — CID 54393194
tert-butyl (2S)-3-methyl-2-[(4-oxo-4-propan-2-yloxybut-2-enyl)amino]butanoate (PubChem CID 54393194) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[(4-oxo-4-propan-2-yloxybut-2-enyl)amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[(4-oxo-4-propan-2-yloxybut-2-enyl)amino]butanoate |
|---|---|
| PubChem CID | 54393194 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[(4-oxo-4-propan-2-yloxybut-2-enyl)amino]butanoate |
| SMILES | CC(C)OC(=O)C=CCN[C@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H29NO4/c1-11(2)14(15(19)21-16(5,6)7)17-10-8-9-13(18)20-12(3)4/h8-9,11-12,14,17H,10H2,1-7H3/t14-/m0/s1 |
| InChIKey | VICZTDBRCFIQDI-AWEZNQCLSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|