C15H27NO4 — CID 54131242
tert-butyl (2R)-2-[(4-ethoxy-4-oxobut-2-enyl)amino]-3-methylbutanoate (PubChem CID 54131242) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-ethoxy-4-oxobut-2-enyl)amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-[(4-ethoxy-4-oxobut-2-enyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 54131242 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | tert-butyl (2R)-2-[(4-ethoxy-4-oxobut-2-enyl)amino]-3-methylbutanoate |
| SMILES | CCOC(=O)C=CCN[C@@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H27NO4/c1-7-19-12(17)9-8-10-16-13(11(2)3)14(18)20-15(4,5)6/h8-9,11,13,16H,7,10H2,1-6H3/t13-/m1/s1 |
| InChIKey | NUNJHNZYZWXSRL-CYBMUJFWSA-N |
| XLogP | 2.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|