C12H16O6 — CID 139924844
(Z)-4-[2-(1-ethenoxyprop-1-en-2-yloxy)propoxy]-4-oxobut-2-enoic acid (PubChem CID 139924844) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is (Z)-4-[2-(1-ethenoxyprop-1-en-2-yloxy)propoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-(1-ethenoxyprop-1-en-2-yloxy)propoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 139924844 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (Z)-4-[2-(1-ethenoxyprop-1-en-2-yloxy)propoxy]-4-oxobut-2-enoic acid |
| SMILES | C=COC=C(C)OC(C)COC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H16O6/c1-4-16-7-9(2)18-10(3)8-17-12(15)6-5-11(13)14/h4-7,10H,1,8H2,2-3H3,(H,13,14)/b6-5-,9-7? |
| InChIKey | PXVRRRNNEKRPTQ-SQYRMKJNSA-N |
| XLogP | 1.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|