C11H16O5 — CID 139924913
2-(1-ethenoxyprop-1-en-2-yloxy)propyl 2-oxopropanoate (PubChem CID 139924913) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(1-ethenoxyprop-1-en-2-yloxy)propyl 2-oxopropanoate.
| Compound Name | 2-(1-ethenoxyprop-1-en-2-yloxy)propyl 2-oxopropanoate |
|---|---|
| PubChem CID | 139924913 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(1-ethenoxyprop-1-en-2-yloxy)propyl 2-oxopropanoate |
| SMILES | C=COC=C(C)OC(C)COC(=O)C(C)=O |
| InChI | InChI=1S/C11H16O5/c1-5-14-6-8(2)16-9(3)7-15-11(13)10(4)12/h5-6,9H,1,7H2,2-4H3 |
| InChIKey | WZLKMCVQVBPDAL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|