C14H20O5 — CID 58882710
1-[(E)-4-formyl-6-oxohex-2-en-2-yl]oxypropan-2-yl 2-methylprop-2-enoate (PubChem CID 58882710) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-[(E)-4-formyl-6-oxohex-2-en-2-yl]oxypropan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[(E)-4-formyl-6-oxohex-2-en-2-yl]oxypropan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58882710 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[(E)-4-formyl-6-oxohex-2-en-2-yl]oxypropan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CO/C(C)=C/C(C=O)CC=O |
| InChI | InChI=1S/C14H20O5/c1-10(2)14(17)19-12(4)9-18-11(3)7-13(8-16)5-6-15/h6-8,12-13H,1,5,9H2,2-4H3/b11-7+ |
| InChIKey | CGCOJWDFWOZXRS-YRNVUSSQSA-N |
| XLogP | 1.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|